Difference between revisions of "CPD0-2354"

Revision as of 15:13, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19161 ==
+== Metabolite D-THREONINE ==
 * common-name:
-** (2e,7z)-tetradecenoyl-coa
+** d-threonine
 * molecular-weight:
-** 969.83
+** 119.12
 * inchi-key:
-** mwksuvqqmpjtpp-dtpvmwfysa-j
+** ayfvyjqapqtccc-sthayslisa-n
 * smiles:
-** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(o)c([n+])c(=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-17793]]
+* [[THREONINE-RACEMASE-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[THREONINE-RACEMASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
+{{#set: common-name=d-threonine}}
-{{#set: molecular-weight=969.83}}
+{{#set: molecular-weight=119.12}}
-{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
+{{#set: inchi-key=inchikey=ayfvyjqapqtccc-sthayslisa-n}}