Difference between revisions of "Protein-N-terminal-L-Arginine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * molecular-weight: ** 519.151 * inchi-key: ** buzogvvqwcxxdp-vpeninkcsa-j * smiles: ** c(op(=o...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cerotoyl-ACPs == * common-name: ** a 3-oxohexacosanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-10060 == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1905 ==
+
== Metabolite 3-oxo-cerotoyl-ACPs ==
 
* common-name:
 
* common-name:
** 8-oxo-dgtp
+
** a 3-oxohexacosanoyl-[acp]
* molecular-weight:
 
** 519.151
 
* inchi-key:
 
** buzogvvqwcxxdp-vpeninkcsa-j
 
* smiles:
 
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10060]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11410]]
+
* [[RXN-10059]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgtp}}
+
{{#set: common-name=a 3-oxohexacosanoyl-[acp]}}
{{#set: molecular-weight=519.151}}
 
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
 

Revision as of 15:13, 15 March 2021

Metabolite 3-oxo-cerotoyl-ACPs

  • common-name:
    • a 3-oxohexacosanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxohexacosanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.