Difference between revisions of "Charged-fMET-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * molecular-weight: ** 167.141 * inchi-key: ** cffzdzcdufsofz-uhfffaoysa-m * smil...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * molecular-weight: ** 362.192 * inchi-key: ** dctlyfzhfgencw-uuokfmhzsa-l * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XANTHOSINE-5-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** xmp |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 362.192 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dctlyfzhfgencw-uuokfmhzsa-l |
* smiles: | * smiles: | ||
| − | ** c([o-])( | + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GMP-SYN-GLUT-RXN]] | ||
| + | * [[GMP-SYN-NH3-RXN]] | ||
| + | * [[IMP-DEHYDROG-RXN]] | ||
| + | * [[XMPXAN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[IMP-DEHYDROG-RXN]] |
| + | * [[RXN0-1603]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xmp}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=362.192}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}} |
Revision as of 15:13, 15 March 2021
Contents
Metabolite XANTHOSINE-5-PHOSPHATE
- common-name:
- xmp
- molecular-weight:
- 362.192
- inchi-key:
- dctlyfzhfgencw-uuokfmhzsa-l
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
