Difference between revisions of "CPD-19169"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-LEU-tRNAs == * common-name: ** an l-leucyl-[trnaleu] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") |
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * molecular-weight: ** 334.323 * inchi-key: ** fhxagoicbfgebf-bqbzgakwsa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-548 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-formylglutathione |
| + | * molecular-weight: | ||
| + | ** 334.323 | ||
| + | * inchi-key: | ||
| + | ** fhxagoicbfgebf-bqbzgakwsa-m | ||
| + | * smiles: | ||
| + | ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-276]] | ||
| + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2962]] |
| + | * [[RXN0-276]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-formylglutathione}} |
| + | {{#set: molecular-weight=334.323}} | ||
| + | {{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite CPD-548
- common-name:
- s-formylglutathione
- molecular-weight:
- 334.323
- inchi-key:
- fhxagoicbfgebf-bqbzgakwsa-m
- smiles:
- c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
