Difference between revisions of "CPD-13754"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-Disulfide-Carrier-Proteins == * common-name: ** a [disulfide-bond carrier protein] with reduced l-cysteine residues == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * molecular-weight: ** 855.924 * inchi-key: ** qyxijuzwssqict-lbprgkrzsa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11407 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thyroxine sulfate |
| + | * molecular-weight: | ||
| + | ** 855.924 | ||
| + | * inchi-key: | ||
| + | ** qyxijuzwssqict-lbprgkrzsa-m | ||
| + | * smiles: | ||
| + | ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10614]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thyroxine sulfate}} |
| + | {{#set: molecular-weight=855.924}} | ||
| + | {{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}} | ||
Revision as of 15:14, 15 March 2021
Contents
Metabolite CPD-11407
- common-name:
- thyroxine sulfate
- molecular-weight:
- 855.924
- inchi-key:
- qyxijuzwssqict-lbprgkrzsa-m
- smiles:
- c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
