Difference between revisions of "RXN-1404"
Jump to navigation
Jump to search
(Created page with "* navigation ** mainpage|mainpage-description ** Special:Ask|SMW-Ask ** workflow|workflow command history ** randompage-url|randompage ** Special:ListFiles|Files * Metabolic n...") |
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * molecular-weight: ** 495.459 * inchi-key: ** qbmstezxamabff-uearnrk...") |
||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite CPD-14602 == | |
− | * | + | * common-name: |
− | ** | + | ** mycophenolic acid o-acyl-glucuronide |
− | * | + | * molecular-weight: |
− | + | ** 495.459 | |
− | + | * inchi-key: | |
− | ** | + | ** qbmstezxamabff-uearnrkisa-m |
− | * | + | * smiles: |
− | ** | + | ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc) |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13607]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=mycophenolic acid o-acyl-glucuronide}} |
− | + | {{#set: molecular-weight=495.459}} | |
− | + | {{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}} | |
− | |||
− | |||
− |
Revision as of 15:14, 15 March 2021
Contents
Metabolite CPD-14602
- common-name:
- mycophenolic acid o-acyl-glucuronide
- molecular-weight:
- 495.459
- inchi-key:
- qbmstezxamabff-uearnrkisa-m
- smiles:
- cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)