Difference between revisions of "Cis-delta21-3-oxo-C40-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NAD-P-OR-NOP == * common-name: ** nad(p)+ == Reaction(s) known to consume the compound == * 6PGLUCONDEHYDROG-RXN * ALCOHOL-DEHYDROG...")
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * molecular-weight: ** 957.819 * inchi-key: ** uuivzebypbpkll-dxazuofzsa-j * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite NAD-P-OR-NOP ==
+
== Metabolite CPD-15637 ==
 
* common-name:
 
* common-name:
−
** nad(p)+
+
** 6-cis-tridecenoyl-coa
 +
* molecular-weight:
 +
** 957.819
 +
* inchi-key:
 +
** uuivzebypbpkll-dxazuofzsa-j
 +
* smiles:
 +
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[RXN-14771]]
−
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 
−
* [[ExchangeSeed-NAD-P-OR-NOP]]
 
−
* [[GAPDHSYNEC-RXN]]
 
−
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 
−
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[INDANOL-DEHYDROGENASE-RXN]]
 
−
* [[LEGHEMOGLOBIN-REDUCTASE-RXN]]
 
−
* [[RXN-2962]]
 
−
* [[RXN-5581]]
 
−
* [[RXN-6002]]
 
−
* [[RXN-6382]]
 
−
* [[RXN-7967]]
 
−
* [[RXN-7968]]
 
−
* [[RXN-9958]]
 
−
* [[RXN0-5293]]
 
−
* [[RXN66-318]]
 
−
* [[TransportSeed-NAD-P-OR-NOP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]]
 
−
* [[BILIVERDIN-REDUCTASE-RXN]]
 
−
* [[ExchangeSeed-NAD-P-OR-NOP]]
 
−
* [[GAPDHSYNEC-RXN]]
 
−
* [[GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN]]
 
−
* [[GDP-6-DEOXY-D-TALOSE-4-DEHYDROGENASE-RXN]]
 
−
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 
−
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 
−
* [[HOMOSERDEHYDROG-RXN]]
 
−
* [[INDANOL-DEHYDROGENASE-RXN]]
 
−
* [[LEGHEMOGLOBIN-REDUCTASE-RXN]]
 
−
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
 
−
* [[PYRROLINECARBREDUCT-RXN]]
 
−
* [[R621-RXN]]
 
−
* [[RXN-12445]]
 
−
* [[RXN-13162]]
 
−
* [[RXN-13443]]
 
−
* [[RXN0-6377]]
 
−
* [[RXN66-281]]
 
−
* [[RXN66-546]]
 
−
* [[TransportSeed-NAD-P-OR-NOP]]
 
−
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=nad(p)+}}
+
{{#set: common-name=6-cis-tridecenoyl-coa}}
 +
{{#set: molecular-weight=957.819}}
 +
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}

Revision as of 18:58, 17 March 2021

Metabolite CPD-15637

  • common-name:
    • 6-cis-tridecenoyl-coa
  • molecular-weight:
    • 957.819
  • inchi-key:
    • uuivzebypbpkll-dxazuofzsa-j
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cis-delta21-3-oxo-C40-ACPs&oldid=37757"