Difference between revisions of "SINAPYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-CITRAMALATE == * common-name: ** (s)-citramalate * molecular-weight: ** 146.099 * inchi-key: ** xftrtwqbiomvpk-yfkpbyrvsa-l * smiles: *...") |
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * molecular-weight: ** 174.113 * inchi-key: ** hlkxyzvtanabhz-reohclbh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CARBAMYUL-L-ASPARTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-carbamoyl-l-aspartate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.113 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hlkxyzvtanabhz-reohclbhsa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc(nc(n)=o)c([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ASPCARBTRANS-RXN]] |
| + | * [[DIHYDROOROT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ASPCARBTRANS-RXN]] |
| + | * [[DIHYDROOROT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-carbamoyl-l-aspartate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.113}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}} |
Revision as of 18:58, 17 March 2021
Contents
Metabolite CARBAMYUL-L-ASPARTATE
- common-name:
- n-carbamoyl-l-aspartate
- molecular-weight:
- 174.113
- inchi-key:
- hlkxyzvtanabhz-reohclbhsa-l
- smiles:
- c(=o)([o-])cc(nc(n)=o)c([o-])=o
