Difference between revisions of "D-GLUCARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-phosphate == * common-name: ** a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(5-phospho-l-glutamyl)-l-glutam...") |
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * molecular-weight: ** 971.802 * inchi-key: ** fdxhxlpclxeysu-hmxwsvnbsa-j *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15676 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-trans-3-oxo-tridecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 971.802 | ||
| + | * inchi-key: | ||
| + | ** fdxhxlpclxeysu-hmxwsvnbsa-j | ||
| + | * smiles: | ||
| + | ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14788]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}} |
| + | {{#set: molecular-weight=971.802}} | ||
| + | {{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}} | ||
Revision as of 18:59, 17 March 2021
Contents
Metabolite CPD-15676
- common-name:
- 6-trans-3-oxo-tridecenoyl-coa
- molecular-weight:
- 971.802
- inchi-key:
- fdxhxlpclxeysu-hmxwsvnbsa-j
- smiles:
- ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
