Difference between revisions of "Protein-S-farnesyl-L-cysteines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * molecular-weight: ** 328.201 * inchi-key: ** ivomouwhdpkrll-kqynxxcusa-m * smiles: ** c3(op(=o)([o...")
(Created page with "Category:metabolite == Metabolite DIACETYL == * common-name: ** diacetyl * molecular-weight: ** 86.09 * inchi-key: ** qsjxefypdanlfs-uhfffaoysa-n * smiles: ** cc(c(c)=o)=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CAMP ==
+
== Metabolite DIACETYL ==
 
* common-name:
 
* common-name:
** cyclic-amp
+
** diacetyl
 
* molecular-weight:
 
* molecular-weight:
** 328.201
+
** 86.09
 
* inchi-key:
 
* inchi-key:
** ivomouwhdpkrll-kqynxxcusa-m
+
** qsjxefypdanlfs-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34))
+
** cc(c(c)=o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5038]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6081]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyclic-amp}}
+
{{#set: common-name=diacetyl}}
{{#set: molecular-weight=328.201}}
+
{{#set: molecular-weight=86.09}}
{{#set: inchi-key=inchikey=ivomouwhdpkrll-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=qsjxefypdanlfs-uhfffaoysa-n}}

Revision as of 18:59, 17 March 2021

Metabolite DIACETYL

  • common-name:
    • diacetyl
  • molecular-weight:
    • 86.09
  • inchi-key:
    • qsjxefypdanlfs-uhfffaoysa-n
  • smiles:
    • cc(c(c)=o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality