Difference between revisions of "Aromatic-Amino-Acids"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19170 ==
+== Metabolite CIT ==
 * common-name:
-** (2e,7z)-hexadecenoyl-coa
+** citrate
 * molecular-weight:
-** 997.883
+** 189.101
 * inchi-key:
-** yqarrkbgbkpbcx-dvzfgldusa-j
+** krknybchxyngox-uhfffaoysa-k
 * smiles:
-** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-17780]]
+* [[ACONITATEDEHYDR-RXN]]
+* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+* [[RXN-14047]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[ACONITATEDEHYDR-RXN]]
+* [[CITSYN-RXN]]
+* [[RXN-14047]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
+{{#set: common-name=citrate}}
-{{#set: molecular-weight=997.883}}
+{{#set: molecular-weight=189.101}}
-{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
+{{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}}