Difference between revisions of "CPD-14375"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYSTINE == * common_name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi_key: ** inchikey=levwyrkdkasidu-imjsid...")
(Created page with "Category:metabolite == Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs == * common-name: ** a cis-keto-c60-meroacyl-[acp] == Reaction(s) known to consume the compound == == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYSTINE ==
+
== Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs ==
* common_name:
+
* common-name:
** l-cystine
+
** a cis-keto-c60-meroacyl-[acp]
* smiles:
 
** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
 
* inchi_key:
 
** inchikey=levwyrkdkasidu-imjsidkusa-n
 
* molecular_weight:
 
** 240.292   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTHIOCYS-RXN]]
 
* [[RXN-15128]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15128]]
+
* [[RXN1G-3641]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=l-cystine}}
+
{{#set: common-name=a cis-keto-c60-meroacyl-[acp]}}
{{#set: inchi_key=inchikey=levwyrkdkasidu-imjsidkusa-n}}
 
{{#set: molecular_weight=240.292    }}
 

Revision as of 18:59, 17 March 2021

Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs

  • common-name:
    • a cis-keto-c60-meroacyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-keto-c60-meroacyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.