Difference between revisions of "RETINOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uracil-54-in-tRNA == * common-name: ** a uracil54 in trna == Reaction(s) known to consume the compound == * 2.1.1.74-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-11519 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa * molecular-weight: ** 1055.92 * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11519 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa |
| + | * molecular-weight: | ||
| + | ** 1055.92 | ||
| + | * inchi-key: | ||
| + | ** pddhcvxpabqiso-xjjfhseksa-j | ||
| + | * smiles: | ||
| + | ** ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10698]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10697]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa}} |
| + | {{#set: molecular-weight=1055.92}} | ||
| + | {{#set: inchi-key=inchikey=pddhcvxpabqiso-xjjfhseksa-j}} | ||
Revision as of 18:59, 17 March 2021
Contents
Metabolite CPD-11519
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa
- molecular-weight:
- 1055.92
- inchi-key:
- pddhcvxpabqiso-xjjfhseksa-j
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
