Difference between revisions of "Trans-D2-cis-cis-D17-35-C54-3-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-METHYL-MALONYL-COA == * common-name: ** (s)-methylmalonyl-coa * molecular-weight: ** 862.568 * inchi-key: ** mzfokikepguzen-ibnuzsncsa-...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 573.303 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qoushgmtbiiahr-keohhstqsa-j |
* smiles: | * smiles: | ||
− | ** | + | ** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PRIBFAICARPISOM-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HISTCYCLOHYD-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=573.303}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}} |
Revision as of 18:59, 17 March 2021
Contents
Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P
- common-name:
- 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
- molecular-weight:
- 573.303
- inchi-key:
- qoushgmtbiiahr-keohhstqsa-j
- smiles:
- c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.