Difference between revisions of "D-Galactosyl-12-diacyl-glycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkyl-sn-glycero-3-phosphocholines == * common-name: ** a 1-alkyl-2-lyso-sn-glycero-3-phosphocholine == Reaction(s) known to consume th...") |
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleoyl-sn-glycerol 3-phosphate * molecular-weight: ** 434.509 * inchi-key: ** wrgqswvcfniunz...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite 1- | + | == Metabolite L-1-LYSOPHOSPHATIDATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-oleoyl-sn-glycerol 3-phosphate |
+ | * molecular-weight: | ||
+ | ** 434.509 | ||
+ | * inchi-key: | ||
+ | ** wrgqswvcfniunz-gdckjwnlsa-l | ||
+ | * smiles: | ||
+ | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15043]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15045]] |
− | * [[ | + | * [[RXN-15046]] |
+ | * [[RXN-15068]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-sn-glycerol 3-phosphate}} |
+ | {{#set: molecular-weight=434.509}} | ||
+ | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} |
Revision as of 18:59, 17 March 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleoyl-sn-glycerol 3-phosphate
- molecular-weight:
- 434.509
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o