Difference between revisions of "GLUTARYL-COA"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14926 ==
+== Metabolite DIHYDROXY-ACETONE-PHOSPHATE ==
 * common-name:
-** phytenal
+** glycerone phosphate
 * molecular-weight:
-** 294.52
+** 168.043
 * inchi-key:
-** rafzysuicbqabu-pyddkjgssa-n
+** gngacratggdkbx-uhfffaoysa-l
 * smiles:
-** cc(c)cccc(c)cccc(c)cccc(c)=c[ch]=o
+** c(c(=o)co)op([o-])([o-])=o
 == Reaction(s) known to consume the compound ==
-* [[RXN66-479]]
+* [[1.1.1.8-RXN]]
+* [[F16ALDOLASE-RXN]]
+* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+* [[QUINOLINATE-SYNTHA-RXN]]
+* [[RXN-15044]]
+* [[RXN0-5257]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRIOSEPISOMERIZATION-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN66-478]]
+* [[F16ALDOLASE-RXN]]
+* [[GLYCERONE-KINASE-RXN]]
+* [[RXN-8631]]
+* [[RXN0-5260]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRIOSEPISOMERIZATION-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=phytenal}}
+{{#set: common-name=glycerone phosphate}}
-{{#set: molecular-weight=294.52}}
+{{#set: molecular-weight=168.043}}
-{{#set: inchi-key=inchikey=rafzysuicbqabu-pyddkjgssa-n}}
+{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}