Difference between revisions of "2E-5Z-tetradeca-2-5-dienoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TETRADEHYDROACYL-COA == * common-name: ** a (2e,4e)-alka-2,4-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12521...") |
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common_name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BENZOYLSUCCINYL-COA == |
| − | * | + | * common_name: |
| − | ** | + | ** benzoylsuccinyl-coa |
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
| + | * inchi_key: | ||
| + | ** inchikey=sgnpjinsckfitg-ihebcorqsa-i | ||
| + | * molecular_weight: | ||
| + | ** 966.676 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-905]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=benzoylsuccinyl-coa}} |
| + | {{#set: inchi_key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}} | ||
| + | {{#set: molecular_weight=966.676 }} | ||
Revision as of 19:00, 17 March 2021
Contents
Metabolite BENZOYLSUCCINYL-COA
- common_name:
- benzoylsuccinyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi_key:
- inchikey=sgnpjinsckfitg-ihebcorqsa-i
- molecular_weight:
- 966.676
