Difference between revisions of "Protein-tyrosine-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SER == * common-name: ** l-serine * molecular-weight: ** 105.093 * inchi-key: ** mtcfgrxmjlqnbg-reohclbhsa-n * smiles: ** c(o)c([n+])c(=o...")
(Created page with "Category:metabolite == Metabolite CPD-14675 == * common-name: ** pristanoyl-coa * molecular-weight: ** 1043.995 * inchi-key: ** xyjpsqpvcbnzht-tukysrjdsa-j * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SER ==
+
== Metabolite CPD-14675 ==
 
* common-name:
 
* common-name:
** l-serine
+
** pristanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 105.093
+
** 1043.995
 
* inchi-key:
 
* inchi-key:
** mtcfgrxmjlqnbg-reohclbhsa-n
+
** xyjpsqpvcbnzht-tukysrjdsa-j
 
* smiles:
 
* smiles:
** c(o)c([n+])c(=o)[o-]
+
** cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.3.1.17-RXN]]
 
* [[5.1.1.18-RXN]]
 
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[GLYOHMETRANS-RXN-SER/THF//GLY/METHYLENE-THF/WATER.33.]]
 
* [[RXN-15125]]
 
* [[RXN-5641]]
 
* [[RXN0-2161]]
 
* [[RXN0-2382]]
 
* [[SERINE--TRNA-LIGASE-RXN]]
 
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
* [[SERINE-O-ACETTRAN-RXN]]
 
* [[TRYPSYN-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+
* [[RXN66-484]]
* [[GLYOHMETRANS-RXN]]
 
* [[GLYOHMETRANS-RXN-SER/THF//GLY/METHYLENE-THF/WATER.33.]]
 
* [[RXN-14136]]
 
* [[RXN0-5114]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-serine}}
+
{{#set: common-name=pristanoyl-coa}}
{{#set: molecular-weight=105.093}}
+
{{#set: molecular-weight=1043.995}}
{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=xyjpsqpvcbnzht-tukysrjdsa-j}}

Revision as of 19:00, 17 March 2021

Metabolite CPD-14675

  • common-name:
    • pristanoyl-coa
  • molecular-weight:
    • 1043.995
  • inchi-key:
    • xyjpsqpvcbnzht-tukysrjdsa-j
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality