Difference between revisions of "CPD-464"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * molecular-weight: ** 346.193 * inchi-key: ** grszfwquakgdav-kqynxxcusa-l * smiles: ** c(op(=o)([o-])[o-])c...")
(Created page with "Category:metabolite == Metabolite Aliphatic-Alpha-Omega-Diamines == * common-name: ** an aliphatic α,ω-diamine == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMP ==
+
== Metabolite Aliphatic-Alpha-Omega-Diamines ==
 
* common-name:
 
* common-name:
** imp
+
** an aliphatic α,ω-diamine
* molecular-weight:
 
** 346.193
 
* inchi-key:
 
** grszfwquakgdav-kqynxxcusa-l
 
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[DIAMTRANSAM-RXN]]
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[RXN-7607]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMP-DEAMINASE-RXN]]
+
* [[DIAMTRANSAM-RXN]]
* [[IMP-DEHYDROG-RXN]]
 
* [[IMPCYCLOHYDROLASE-RXN]]
 
* [[RXN-14003]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imp}}
+
{{#set: common-name=an aliphatic α,ω-diamine}}
{{#set: molecular-weight=346.193}}
 
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 

Revision as of 19:00, 17 March 2021

Metabolite Aliphatic-Alpha-Omega-Diamines

  • common-name:
    • an aliphatic α,ω-diamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality