Difference between revisions of "N-4-aminobutylidene-enzyme-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-1346 == * common-name: ** trehalose-trans-methoxy-mono-mycolate * molecular-weight: ** 1592.571 * inchi-key: ** amromufvhnpoeq-bzzo...") |
(Created page with "Category:metabolite == Metabolite PORPHOBILINOGEN == * common-name: ** porphobilinogen * molecular-weight: ** 225.224 * inchi-key: ** qshwiqzfgqkfma-uhfffaoysa-m * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PORPHOBILINOGEN == |
* common-name: | * common-name: | ||
| − | ** | + | ** porphobilinogen |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 225.224 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qshwiqzfgqkfma-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[OHMETHYLBILANESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PORPHOBILSYNTH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=porphobilinogen}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=225.224}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qshwiqzfgqkfma-uhfffaoysa-m}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite PORPHOBILINOGEN
- common-name:
- porphobilinogen
- molecular-weight:
- 225.224
- inchi-key:
- qshwiqzfgqkfma-uhfffaoysa-m
- smiles:
- c(c1(=c(c(=cn1)ccc(=o)[o-])cc(=o)[o-]))[n+]
