Difference between revisions of "Fatty-Aldehydes"

Revision as of 19:00, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI ==
+== Metabolite Donor-H2 ==
 * common-name:
-** leukotriene b4
+** a reduced electron acceptor
-* molecular-weight:
-** 335.462
-* inchi-key:
-** vnyssyrcgwbhlg-amolwhmgsa-m
-* smiles:
-** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
 == Reaction(s) known to consume the compound ==
+* [[1.3.99.23-RXN]]
+* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
+* [[ExchangeSeed-Donor-H2]]
+* [[NADH-DEHYDROGENASE-RXN]]
+* [[NADPH-DEHYDROGENASE-RXN]]
+* [[R07063]]
+* [[R07861]]
+* [[RXN-10851]]
+* [[RXN-11922]]
+* [[RXN-12473]]
+* [[RXN-13445]]
+* [[RXN-8667]]
+* [[SELENOCYSTEINE-LYASE-RXN]]
+* [[SULFITE-REDUCTASE-RXN]]
+* [[TransportSeed-Donor-H2]]
 == Reaction(s) known to produce the compound ==
-* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+* [[ExchangeSeed-Donor-H2]]
+* [[NADH-DEHYDROGENASE-RXN]]
+* [[NADPH-DEHYDROGENASE-RXN]]
+* [[R07861]]
+* [[RXN-10851]]
+* [[RXN-10981]]
+* [[RXN-6081]]
+* [[SULFITE-REDUCTASE-RXN]]
+* [[THIOREDOXIN-RXN]]
+* [[TransportSeed-Donor-H2]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=leukotriene b4}}
+{{#set: common-name=a reduced electron acceptor}}
-{{#set: molecular-weight=335.462}}
-{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}