Difference between revisions of "CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Pimeloyl-ACP-methyl-esters == * common-name: ** a pimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound == == Reaction...")
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * molecular-weight: ** 177.16 * inchi-key: ** sfyvzosiaizwqu-vkhmyheasa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Pimeloyl-ACP-methyl-esters ==
+
== Metabolite O-UREIDOHOMOSERINE ==
 
* common-name:
 
* common-name:
** a pimeloyl-[acp] methyl ester
+
** o-ureido-l-homoserine
 +
* molecular-weight:
 +
** 177.16
 +
* inchi-key:
 +
** sfyvzosiaizwqu-vkhmyheasa-n
 +
* smiles:
 +
** c(cc(c(=o)[o-])[n+])onc(n)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11482]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pimeloyl-[acp] methyl ester}}
+
{{#set: common-name=o-ureido-l-homoserine}}
 +
{{#set: molecular-weight=177.16}}
 +
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}

Revision as of 19:00, 17 March 2021

Metabolite O-UREIDOHOMOSERINE

  • common-name:
    • o-ureido-l-homoserine
  • molecular-weight:
    • 177.16
  • inchi-key:
    • sfyvzosiaizwqu-vkhmyheasa-n
  • smiles:
    • c(cc(c(=o)[o-])[n+])onc(n)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality