Difference between revisions of "CPD-5662"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-I-CIT == * common_name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] * inchi_key: ** inchikey=oejzz...") |
(Created page with "Category:metabolite == Metabolite CPD-7994 == * common-name: ** n-methyl-δ1-pyrrolinium cation * molecular-weight: ** 84.141 * inchi-key: ** fdwzaogdovqold-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7994 == |
| − | * | + | * common-name: |
| − | ** | + | ** n-methyl-δ1-pyrrolinium cation |
| + | * molecular-weight: | ||
| + | ** 84.141 | ||
| + | * inchi-key: | ||
| + | ** fdwzaogdovqold-uhfffaoysa-n | ||
* smiles: | * smiles: | ||
| − | ** c | + | ** c[n+]1(cccc=1) |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-8246]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=n-methyl-δ1-pyrrolinium cation}} |
| − | {{#set: | + | {{#set: molecular-weight=84.141}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=fdwzaogdovqold-uhfffaoysa-n}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-7994
- common-name:
- n-methyl-δ1-pyrrolinium cation
- molecular-weight:
- 84.141
- inchi-key:
- fdwzaogdovqold-uhfffaoysa-n
- smiles:
- c[n+]1(cccc=1)
