Difference between revisions of "GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * molecular-weight: ** 178.141 * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-n * smil...") |
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * molecular-weight: ** 1053.904 * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11520 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1053.904 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yyccmactoajggw-ozvhgmpnsa-j |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10699]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10698]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1053.904}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-11520
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
- molecular-weight:
- 1053.904
- inchi-key:
- yyccmactoajggw-ozvhgmpnsa-j
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
