Difference between revisions of "Cysteine-Desulfurase-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXALATE == * common-name: ** oxalate * molecular-weight: ** 88.02 * inchi-key: ** mubzpkhoepujkr-uhfffaoysa-l * smiles: ** c([o-])(c(=o)[...") |
(Created page with "Category:metabolite == Metabolite ADP-D-GLUCOSE == * common-name: ** adp-α-d-glucose * molecular-weight: ** 587.33 * inchi-key: ** wfpzsxyxpsuopy-roywqjlosa-l * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ADP-D-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** adp-α-d-glucose |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 587.33 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wfpzsxyxpsuopy-roywqjlosa-l |
* smiles: | * smiles: | ||
| − | ** c([o-]) | + | ** c(c1(c(c(c(c(o1)op(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))(=o)[o-])(=o)[o-])o)o)o))o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUC1PADENYLTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adp-α-d-glucose}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=587.33}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wfpzsxyxpsuopy-roywqjlosa-l}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite ADP-D-GLUCOSE
- common-name:
- adp-α-d-glucose
- molecular-weight:
- 587.33
- inchi-key:
- wfpzsxyxpsuopy-roywqjlosa-l
- smiles:
- c(c1(c(c(c(c(o1)op(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))(=o)[o-])(=o)[o-])o)o)o))o
