Difference between revisions of "3-KETO-ADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA == * common-name: ** 2-protocatechuoylphloroglucinolcarboxylate * molecular-weight: ** 305.22 *...")
(Created page with "Category:metabolite == Metabolite CPD-19162 == * common-name: ** (2e,9z)-hexadecenoyl-coa * molecular-weight: ** 997.883 * inchi-key: ** beqwcbbskhmrca-henmzmgosa-j * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA ==
+
== Metabolite CPD-19162 ==
 
* common-name:
 
* common-name:
** 2-protocatechuoylphloroglucinolcarboxylate
+
** (2e,9z)-hexadecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 305.22
+
** 997.883
 
* inchi-key:
 
* inchi-key:
** grxielrcpyieqi-uhfffaoysa-m
+
** beqwcbbskhmrca-henmzmgosa-j
 
* smiles:
 
* smiles:
** c(c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(=c(c=2)o)o))=o))([o-])=o
+
** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-protocatechuoylphloroglucinolcarboxylate}}
+
{{#set: common-name=(2e,9z)-hexadecenoyl-coa}}
{{#set: molecular-weight=305.22}}
+
{{#set: molecular-weight=997.883}}
{{#set: inchi-key=inchikey=grxielrcpyieqi-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=beqwcbbskhmrca-henmzmgosa-j}}

Revision as of 19:00, 17 March 2021

Metabolite CPD-19162

  • common-name:
    • (2e,9z)-hexadecenoyl-coa
  • molecular-weight:
    • 997.883
  • inchi-key:
    • beqwcbbskhmrca-henmzmgosa-j
  • smiles:
    • ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality