Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * molecular-weight: ** 399.167 * inchi-key: ** ujlxyodchaelly-xlpzgreqsa-k * smiles: ** cc1(=cn(c(=o)nc(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * molecular-weight: ** 297.305 * inchi-key: ** ucajznvfrvluls-uhfffaoysa-m * sm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12017 == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-serotonin sulfate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 297.305 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ucajznvfrvluls-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11059]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-serotonin sulfate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=297.305}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-12017
- common-name:
- n-acetyl-serotonin sulfate
- molecular-weight:
- 297.305
- inchi-key:
- ucajznvfrvluls-uhfffaoysa-m
- smiles:
- cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))