Difference between revisions of "ACETYL-GLU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * molecular-weight: ** 971.845 * inchi-key: ** mrvdzohjmltlhj-stfckwfxsa-j * smiles...")
(Created page with "Category:metabolite == Metabolite CPD-13913 == * common-name: ** 2-carboxy-l-xylonolactone * molecular-weight: ** 191.117 * inchi-key: ** znjunwarrixwaa-uhfffaoysa-m * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15436 ==
+
== Metabolite CPD-13913 ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** 2-carboxy-l-xylonolactone
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 191.117
 
* inchi-key:
 
* inchi-key:
** mrvdzohjmltlhj-stfckwfxsa-j
+
** znjunwarrixwaa-uhfffaoysa-m
 
* smiles:
 
* smiles:
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(o)c1(oc(=o)c(o)(c(=o)[o-])c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
+
* [[RXN-12871]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[RXN-12870]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=2-carboxy-l-xylonolactone}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=191.117}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
+
{{#set: inchi-key=inchikey=znjunwarrixwaa-uhfffaoysa-m}}

Revision as of 19:00, 17 March 2021

Metabolite CPD-13913

  • common-name:
    • 2-carboxy-l-xylonolactone
  • molecular-weight:
    • 191.117
  • inchi-key:
    • znjunwarrixwaa-uhfffaoysa-m
  • smiles:
    • c(o)c1(oc(=o)c(o)(c(=o)[o-])c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality