Difference between revisions of "CDPDIACYLGLYCEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * molecular-weight: ** 258.144 * inchi-key: ** zwzwygmenqvnfu-uhnvwzdzsa-m * smiles:...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-atp * molecular-weight: ** 714.24 * inchi-key: ** rknhjbvbfhdxgr-k...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-ATP == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-(5-phospho-β-d-ribosyl)-atp |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 714.24 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rknhjbvbfhdxgr-keohhstqsa-i |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ATPPHOSPHORIBOSYLTRANS-RXN]] |
+ | * [[HISTPRATPHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ATPPHOSPHORIBOSYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=714.24}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite PHOSPHORIBOSYL-ATP
- common-name:
- 1-(5-phospho-β-d-ribosyl)-atp
- molecular-weight:
- 714.24
- inchi-key:
- rknhjbvbfhdxgr-keohhstqsa-i
- smiles:
- c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o