Difference between revisions of "Ribonucleoside-Diphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE == * common-name: ** glucoiberverin * molecular-weight: ** 406.46 * inchi-key: ** zczcvjvujgulmo-bzvdqrp...")
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * molecular-weight: ** 566.699 * inchi-key: ** uhsgpdmiqqynax-uhfffaoysa-l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYLTHIOPROPYL-GLUCOSINOLATE ==
+
== Metabolite PROTOPORPHYRINOGEN ==
 
* common-name:
 
* common-name:
** glucoiberverin
+
** protoporphyrinogen ix
 
* molecular-weight:
 
* molecular-weight:
** 406.46
+
** 566.699
 
* inchi-key:
 
* inchi-key:
** zczcvjvujgulmo-bzvdqrpcsa-m
+
** uhsgpdmiqqynax-uhfffaoysa-l
 
* smiles:
 
* smiles:
** cscccc(=nos(=o)(=o)[o-])sc1(oc(co)c(o)c(o)c(o)1)
+
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2221]]
+
* [[PROTOPORGENOXI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HEMN-RXN]]
 +
* [[RXN0-1461]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glucoiberverin}}
+
{{#set: common-name=protoporphyrinogen ix}}
{{#set: molecular-weight=406.46}}
+
{{#set: molecular-weight=566.699}}
{{#set: inchi-key=inchikey=zczcvjvujgulmo-bzvdqrpcsa-m}}
+
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}

Revision as of 19:01, 17 March 2021

Metabolite PROTOPORPHYRINOGEN

  • common-name:
    • protoporphyrinogen ix
  • molecular-weight:
    • 566.699
  • inchi-key:
    • uhsgpdmiqqynax-uhfffaoysa-l
  • smiles:
    • c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality