Difference between revisions of "Cis-5-enoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * molecular-weight: ** 416.686 * inchi-key: ** quedxnhftdjviy-dqczwyhmsa-n * smil...")
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * molecular-weight: ** 384.301 * inchi-key: ** mcthlmsflmebek-aaeuagobsa-l * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAMA-TOCOPHEROL ==
+
== Metabolite CPD-8890 ==
 
* common-name:
 
* common-name:
** γ-tocopherol
+
** betanidin quinone
 
* molecular-weight:
 
* molecular-weight:
** 416.686
+
** 384.301
 
* inchi-key:
 
* inchi-key:
** quedxnhftdjviy-dqczwyhmsa-n
+
** mcthlmsflmebek-aaeuagobsa-l
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+
** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2543]]
+
* [[RXN-8635]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-tocopherol}}
+
{{#set: common-name=betanidin quinone}}
{{#set: molecular-weight=416.686}}
+
{{#set: molecular-weight=384.301}}
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
+
{{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-8890

  • common-name:
    • betanidin quinone
  • molecular-weight:
    • 384.301
  • inchi-key:
    • mcthlmsflmebek-aaeuagobsa-l
  • smiles:
    • c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality