Difference between revisions of "Cis-5-enoyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * molecular-weight: ** 416.686 * inchi-key: ** quedxnhftdjviy-dqczwyhmsa-n * smil...") |
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * molecular-weight: ** 384.301 * inchi-key: ** mcthlmsflmebek-aaeuagobsa-l * smiles: ** c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8890 == |
* common-name: | * common-name: | ||
− | ** | + | ** betanidin quinone |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 384.301 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mcthlmsflmebek-aaeuagobsa-l |
* smiles: | * smiles: | ||
− | ** | + | ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8635]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=betanidin quinone}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=384.301}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite CPD-8890
- common-name:
- betanidin quinone
- molecular-weight:
- 384.301
- inchi-key:
- mcthlmsflmebek-aaeuagobsa-l
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)