Difference between revisions of "CPD-334"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13684 == * common-name: ** cholest-5-en-3-one * molecular-weight: ** 384.644 * inchi-key: ** ggclnoigpmgldb-gykmgiidsa-n * smiles: **...") |
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * molecular-weight: ** 847.62 * inchi-key: ** uyvziwwbjmyrcd-zmhdxicwsa-j * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ISOVALERYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** isovaleryl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 847.62 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** uyvziwwbjmyrcd-zmhdxicwsa-j |
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]] |
+ | * [[RXN-14264]] | ||
+ | * [[RXN0-2301]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]] |
+ | * [[RXN-14264]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isovaleryl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=847.62}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite ISOVALERYL-COA
- common-name:
- isovaleryl-coa
- molecular-weight:
- 847.62
- inchi-key:
- uyvziwwbjmyrcd-zmhdxicwsa-j
- smiles:
- cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c