Difference between revisions of "CPD-334"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13684 == * common-name: ** cholest-5-en-3-one * molecular-weight: ** 384.644 * inchi-key: ** ggclnoigpmgldb-gykmgiidsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * molecular-weight: ** 847.62 * inchi-key: ** uyvziwwbjmyrcd-zmhdxicwsa-j * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13684 ==
+
== Metabolite ISOVALERYL-COA ==
 
* common-name:
 
* common-name:
** cholest-5-en-3-one
+
** isovaleryl-coa
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 847.62
 
* inchi-key:
 
* inchi-key:
** ggclnoigpmgldb-gykmgiidsa-n
+
** uyvziwwbjmyrcd-zmhdxicwsa-j
 
* smiles:
 
* smiles:
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12693]]
+
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
 +
* [[RXN-14264]]
 +
* [[RXN0-2301]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12693]]
+
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
 +
* [[RXN-14264]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholest-5-en-3-one}}
+
{{#set: common-name=isovaleryl-coa}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=847.62}}
{{#set: inchi-key=inchikey=ggclnoigpmgldb-gykmgiidsa-n}}
+
{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}

Revision as of 19:01, 17 March 2021

Metabolite ISOVALERYL-COA

  • common-name:
    • isovaleryl-coa
  • molecular-weight:
    • 847.62
  • inchi-key:
    • uyvziwwbjmyrcd-zmhdxicwsa-j
  • smiles:
    • cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality