Difference between revisions of "CPD-14553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N1-ACETYLSPERMINE == * common-name: ** n1-acetylspermine * molecular-weight: ** 247.403 * inchi-key: ** gunurvwajrruav-uhfffaoysa-q * smi...")
(Created page with "Category:metabolite == Metabolite 1-Alkenylglycerophosphoethanolamines == * common-name: ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N1-ACETYLSPERMINE ==
+
== Metabolite 1-Alkenylglycerophosphoethanolamines ==
 
* common-name:
 
* common-name:
** n1-acetylspermine
+
** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine
* molecular-weight:
 
** 247.403
 
* inchi-key:
 
** gunurvwajrruav-uhfffaoysa-q
 
* smiles:
 
** cc(=o)nccc[n+]cccc[n+]ccc[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[POLYAMINE-OXIDASE-RXN]]
 
* [[RXN-12090]]
 
* [[RXN-9940]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17735]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-acetylspermine}}
+
{{#set: common-name=a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine}}
{{#set: molecular-weight=247.403}}
 
{{#set: inchi-key=inchikey=gunurvwajrruav-uhfffaoysa-q}}
 

Revision as of 19:01, 17 March 2021

Metabolite 1-Alkenylglycerophosphoethanolamines

  • common-name:
    • a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality