Difference between revisions of "ADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * molecular-weight: ** 381.388 * inchi-key: ** htdhrclvwuexis-gihywfgssa-n * smile...") |
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * molecular-weight: ** 285.232 * inchi-key: ** vevzsmaejfvwil-uhfffaoysa-m * smiles: ** c3(c(c1(c(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-591 == |
* common-name: | * common-name: | ||
− | ** | + | ** cyanidin |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 285.232 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vevzsmaejfvwil-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9725]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cyanidin}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.232}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite CPD-591
- common-name:
- cyanidin
- molecular-weight:
- 285.232
- inchi-key:
- vevzsmaejfvwil-uhfffaoysa-m
- smiles:
- c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)