Difference between revisions of "Cellular-Retinol-Binding-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * molecular-weight: ** 582.655 * inchi-key: ** dkmlmzvdtgoegu-aikfxvfzsa-l...")
(Created page with "Category:metabolite == Metabolite Red-NADPH-Hemoprotein-Reductases == * common-name: ** a reduced [nadph-hemoprotein reductase] == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3Z-PHYTOCHROMOBILIN ==
+
== Metabolite Red-NADPH-Hemoprotein-Reductases ==
 
* common-name:
 
* common-name:
** (3z)-phytochromobilin
+
** a reduced [nadph-hemoprotein reductase]
* molecular-weight:
 
** 582.655
 
* inchi-key:
 
** dkmlmzvdtgoegu-aikfxvfzsa-l
 
* smiles:
 
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.14.13.79-RXN]]
 +
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 +
* [[RXN-1121]]
 +
* [[RXN-11881]]
 +
* [[RXN-4225]]
 +
* [[RXN-4231]]
 +
* [[RXN-5962]]
 +
* [[RXN-715]]
 +
* [[RXN-773]]
 +
* [[RXN1F-160]]
 +
* [[RXN1F-161]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.4-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=a reduced [nadph-hemoprotein reductase]}}
{{#set: molecular-weight=582.655}}
 
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
 

Revision as of 19:01, 17 March 2021

Metabolite Red-NADPH-Hemoprotein-Reductases

  • common-name:
    • a reduced [nadph-hemoprotein reductase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced [nadph-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.