Difference between revisions of "Proteins-with-correct-disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * molecular-weight: ** 304.256 * inchi-key: ** yaagnrwejszflv-zdusscgksa-n...")
(Created page with "Category:metabolite == Metabolite 5-OXOPROLYL-PEPTIDE == * common_name: ** a peptide with n-terminal 5-oxo-l-proline == Reaction(s) known to consume the compound == * GL...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19726 ==
+
== Metabolite 5-OXOPROLYL-PEPTIDE ==
* common-name:
+
* common_name:
** (4s)-2,3-dehydro-leucocyanidin
+
** a peptide with n-terminal 5-oxo-l-proline
* molecular-weight:
 
** 304.256
 
* inchi-key:
 
** yaagnrwejszflv-zdusscgksa-n
 
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLUTAMINYL-PEPTIDE-CYCLOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-602]]
+
* [[GLUTAMINYL-PEPTIDE-CYCLOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}}
+
{{#set: common_name=a peptide with n-terminal 5-oxo-l-proline}}
{{#set: molecular-weight=304.256}}
 
{{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}}
 

Revision as of 19:01, 17 March 2021

Metabolite 5-OXOPROLYL-PEPTIDE

  • common_name:
    • a peptide with n-terminal 5-oxo-l-proline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality