Difference between revisions of "CPD-17400"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...") |
(Created page with "Category:metabolite == Metabolite CPD-12831 == * common-name: ** phylloquinol * molecular-weight: ** 452.719 * inchi-key: ** bufjihpugzhthl-nkffzriasa-n * smiles: ** cc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12831 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phylloquinol |
| + | * molecular-weight: | ||
| + | ** 452.719 | ||
| + | * inchi-key: | ||
| + | ** bufjihpugzhthl-nkffzriasa-n | ||
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(c(=c(o)c1(c=cc=cc=1c=2o))c) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7569]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phylloquinol}} |
| + | {{#set: molecular-weight=452.719}} | ||
| + | {{#set: inchi-key=inchikey=bufjihpugzhthl-nkffzriasa-n}} | ||
Revision as of 19:01, 17 March 2021
Contents
Metabolite CPD-12831
- common-name:
- phylloquinol
- molecular-weight:
- 452.719
- inchi-key:
- bufjihpugzhthl-nkffzriasa-n
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=ccc2(c(=c(o)c1(c=cc=cc=1c=2o))c)
