Difference between revisions of "Gamma-linolenoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** prenyl diphosphate * molecular-weight: ** 243.069 * inchi-key: ** cbidrcwhncksto-uhfffaoysa-k * smiles: **...") |
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * molecular-weight: ** 259.069 * inchi-ke...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HYDROXY-METHYL-BUTENYL-DIP == |
* common-name: | * common-name: | ||
| − | ** | + | ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 259.069 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mdsizrkjvdmqoq-gorduthdsa-k |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ISPH2-RXN]] |
| − | * [[ | + | * [[RXN0-884]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN0-882]] | |
| − | * [[RXN0- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=259.069}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- common-name:
- (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- molecular-weight:
- 259.069
- inchi-key:
- mdsizrkjvdmqoq-gorduthdsa-k
- smiles:
- cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
