Difference between revisions of "NADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * molecular-weight: ** 931.738 * inchi-key: ** azcvxmaplhsiky-hsjnekgzsa-j * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * molecular-weight: ** 103.097 * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2123 ==
+
== Metabolite CPD-335 ==
 
* common-name:
 
* common-name:
** 3-oxodecanoyl-coa
+
** (r)-3-hydroxybutanoate
 
* molecular-weight:
 
* molecular-weight:
** 931.738
+
** 103.097
 
* inchi-key:
 
* inchi-key:
** azcvxmaplhsiky-hsjnekgzsa-j
+
** whbmmwsbfzvssr-gsvougtgsa-m
 
* smiles:
 
* smiles:
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(cc([o-])=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13617]]
+
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12490]]
+
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxodecanoyl-coa}}
+
{{#set: common-name=(r)-3-hydroxybutanoate}}
{{#set: molecular-weight=931.738}}
+
{{#set: molecular-weight=103.097}}
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=whbmmwsbfzvssr-gsvougtgsa-m}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-335

  • common-name:
    • (r)-3-hydroxybutanoate
  • molecular-weight:
    • 103.097
  • inchi-key:
    • whbmmwsbfzvssr-gsvougtgsa-m
  • smiles:
    • cc(cc([o-])=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality