Difference between revisions of "PALMITYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * molecular-weight: ** 564.289 * inchi-key: ** hscjrczfdfqwrp-jzmiexbbsa-l * smiles:...")
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12575 ==
+
== Metabolite Gamma-linolenoyl-groups ==
 
* common-name:
 
* common-name:
** udp-α-d-glucose
+
** a [glycerolipid]-γ-linolenate
* molecular-weight:
 
** 564.289
 
* inchi-key:
 
** hscjrczfdfqwrp-jzmiexbbsa-l
 
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-16043]]
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
* [[2.4.1.117-RXN]]
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-1223]]
 
* [[RXN-15117]]
 
* [[RXN-16975]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-5482]]
 
* [[RXN-7828]]
 
* [[RXN-8228]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UGD-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[UDPGLUCEPIM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-glucose}}
+
{{#set: common-name=a [glycerolipid]-&gamma;-linolenate}}
{{#set: molecular-weight=564.289}}
 
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
 

Revision as of 19:01, 17 March 2021

Metabolite Gamma-linolenoyl-groups

  • common-name:
    • a [glycerolipid]-γ-linolenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.