Difference between revisions of "PROPIONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THR == * common-name: ** l-threonine * molecular-weight: ** 119.12 * inchi-key: ** ayfvyjqapqtccc-gbxijsldsa-n * smiles: ** cc(o)c([n+])c...") |
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,4)-bisphosphate * molecular-weight: ** 336.085 * inchi-key: ** pelzspzcx...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INOSITOL-1-4-BISPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-myo-inositol (1,4)-bisphosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 336.085 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pelzspzcxgtumr-rtphhqfdsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.57-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.3.56-RXN]] |
| − | * [[ | + | * [[RXN-13334]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,4)-bisphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite INOSITOL-1-4-BISPHOSPHATE
- common-name:
- d-myo-inositol (1,4)-bisphosphate
- molecular-weight:
- 336.085
- inchi-key:
- pelzspzcxgtumr-rtphhqfdsa-j
- smiles:
- c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
