Difference between revisions of "VAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * molecular-weight: ** 867.61 * inchi-key: ** vevjtunlalkrno-tyhxjlicsa-j * smiles: ** cc(c)(...")
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * molecular-weight: ** 564.289 * inchi-key: ** hscjrczfdfqwrp-jzmiexbbsa-l * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite BENZOYLCOA ==
+
== Metabolite CPD-12575 ==
 
* common-name:
 
* common-name:
−
** benzoyl-coa
+
** udp-α-d-glucose
 
* molecular-weight:
 
* molecular-weight:
−
** 867.61
+
** 564.289
 
* inchi-key:
 
* inchi-key:
−
** vevjtunlalkrno-tyhxjlicsa-j
+
** hscjrczfdfqwrp-jzmiexbbsa-l
 
* smiles:
 
* smiles:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[2.4.1.117-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-1223]]
 +
* [[RXN-15117]]
 +
* [[RXN-16975]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-5482]]
 +
* [[RXN-7828]]
 +
* [[RXN-8228]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UGD-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-2006]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=benzoyl-coa}}
+
{{#set: common-name=udp-&alpha;-d-glucose}}
−
{{#set: molecular-weight=867.61}}
+
{{#set: molecular-weight=564.289}}
−
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-12575

  • common-name:
    • udp-α-d-glucose
  • molecular-weight:
    • 564.289
  • inchi-key:
    • hscjrczfdfqwrp-jzmiexbbsa-l
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=VAL&oldid=38928"