Difference between revisions of "5-Phospho-RNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * molecular-weight: ** 228.204 * inchi-key: ** mxhrcpnrjammim-shyzeuofsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite Tripeptidyl-Peptidase-I-Substrates == * common-name: ** a tripeptidyl-peptidase i substrate == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite DEOXYURIDINE ==
+
== Metabolite Tripeptidyl-Peptidase-I-Substrates ==
 
* common-name:
 
* common-name:
−
** 2'-deoxyuridine
+
** a tripeptidyl-peptidase i substrate
−
* molecular-weight:
 
−
** 228.204
 
−
* inchi-key:
 
−
** mxhrcpnrjammim-shyzeuofsa-n
 
−
* smiles:
 
−
** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.14.9-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[CYTIDEAM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2'-deoxyuridine}}
+
{{#set: common-name=a tripeptidyl-peptidase i substrate}}
−
{{#set: molecular-weight=228.204}}
 
−
{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
 

Revision as of 19:02, 17 March 2021

Metabolite Tripeptidyl-Peptidase-I-Substrates

  • common-name:
    • a tripeptidyl-peptidase i substrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=5-Phospho-RNA&oldid=39000"