Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * molecular-weight: ** 378.376 * inchi-key: ** vdydcvuwiliyqf-csmhcco...")
(Created page with "Category:metabolite == Metabolite Diamines == * common-name: ** a diamine == Reaction(s) known to consume the compound == * RXN-9599 == Reaction(s) known to produce th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-LACTOYL-GLUTATHIONE ==
+
== Metabolite Diamines ==
 
* common-name:
 
* common-name:
** (r)-s-lactoylglutathione
+
** a diamine
* molecular-weight:
 
** 378.376
 
* inchi-key:
 
** vdydcvuwiliyqf-csmhccousa-m
 
* smiles:
 
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYOXI-RXN]]
+
* [[RXN-9599]]
* [[GLYOXII-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYOXI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-s-lactoylglutathione}}
+
{{#set: common-name=a diamine}}
{{#set: molecular-weight=378.376}}
 
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
 

Revision as of 19:02, 17 March 2021

Metabolite Diamines

  • common-name:
    • a diamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality