Difference between revisions of "METHYL-BETA-D-GALACTOSIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * inchi-key: ** sufzkubnovdjrr-wgeodtkdsa...") |
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * molecular-weight: ** 805.885 * inchi-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11939 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 805.885 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hhqooerqsfjgep-zsiqdkgesa-a |
* smiles: | * smiles: | ||
− | ** | + | ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10973]] |
+ | * [[RXN-10979]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=805.885}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-11939
- common-name:
- 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
- molecular-weight:
- 805.885
- inchi-key:
- hhqooerqsfjgep-zsiqdkgesa-a
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)