Difference between revisions of "CPD-452"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Phosphorylase-a == * common-name: ** a phosphorylase a == Reaction(s) known to consume the compound == * 2.7.11.19-RXN == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * molecular-weight: ** 304.087 * inchi-key: ** sigqqubjqxsamw-zcfiwibfsa-j * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Phosphorylase-a ==
+
== Metabolite CPD-641 ==
 
* common-name:
 
* common-name:
** a phosphorylase a
+
** (r)-mevalonate diphosphate
 +
* molecular-weight:
 +
** 304.087
 +
* inchi-key:
 +
** sigqqubjqxsamw-zcfiwibfsa-j
 +
* smiles:
 +
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.19-RXN]]
+
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.19-RXN]]
+
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a phosphorylase a}}
+
{{#set: common-name=(r)-mevalonate diphosphate}}
 +
{{#set: molecular-weight=304.087}}
 +
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}

Revision as of 19:02, 17 March 2021

Metabolite CPD-641

  • common-name:
    • (r)-mevalonate diphosphate
  • molecular-weight:
    • 304.087
  • inchi-key:
    • sigqqubjqxsamw-zcfiwibfsa-j
  • smiles:
    • cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality