Difference between revisions of "FARNESYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17894 == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate) * molecular-weight: ** 1012.461 * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * molecular-weight: ** 941.776 * inchi-key: ** arquzfjqpywssl-nbluimthsa-j...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17894 ==
+
== Metabolite CPD-15688 ==
 
* common-name:
 
* common-name:
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
+
** (3z,5e)-dodeca-3,5-dienoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 1012.461
+
** 941.776
 
* inchi-key:
 
* inchi-key:
** mbyvktiiznuhkn-nivaaieqsa-m
+
** arquzfjqpywssl-nbluimthsa-j
 
* smiles:
 
* smiles:
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
+
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16602]]
+
* [[RXN-14799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}}
+
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
{{#set: molecular-weight=1012.461}}
+
{{#set: molecular-weight=941.776}}
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
+
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}

Revision as of 19:02, 17 March 2021

Metabolite CPD-15688

  • common-name:
    • (3z,5e)-dodeca-3,5-dienoyl-coa
  • molecular-weight:
    • 941.776
  • inchi-key:
    • arquzfjqpywssl-nbluimthsa-j
  • smiles:
    • ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality