Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17621 == * common-name: ** 16-hydroxypalmitoyl-coa * molecular-weight: ** 1017.914 * inchi-key: ** rozgnndroqhxpf-bbecnahfsa-j * smil...")
(Created page with "Category:metabolite == Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P == * common-name: ** 3-deoxy-d-arabino-heptulosonate 7-phosphate * molecular-weight: ** 285.124 * inc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17621 ==
+
== Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P ==
 
* common-name:
 
* common-name:
** 16-hydroxypalmitoyl-coa
+
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 1017.914
+
** 285.124
 
* inchi-key:
 
* inchi-key:
** rozgnndroqhxpf-bbecnahfsa-j
+
** pjwipexiffqaqz-pufimzngsa-k
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
 +
* [[DAHPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16389]]
+
* [[DAHPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=16-hydroxypalmitoyl-coa}}
+
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
{{#set: molecular-weight=1017.914}}
+
{{#set: molecular-weight=285.124}}
{{#set: inchi-key=inchikey=rozgnndroqhxpf-bbecnahfsa-j}}
+
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}

Revision as of 19:02, 17 March 2021

Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P

  • common-name:
    • 3-deoxy-d-arabino-heptulosonate 7-phosphate
  • molecular-weight:
    • 285.124
  • inchi-key:
    • pjwipexiffqaqz-pufimzngsa-k
  • smiles:
    • c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality