Difference between revisions of "Cis-cis-D19-37-C56-2-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * molecular-weight: ** 325.294 * inchi-key: ** gvriyimnjgulcz-qlfwqt...") |
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * molecular-weight: ** 185.136 * inchi-key: ** dvtpryhenf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14443 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 185.136 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dvtpryhenfbcii-imjsidkusa-l |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14014]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIHYDRODIPICSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=185.136}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-14443
- common-name:
- (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- molecular-weight:
- 185.136
- inchi-key:
- dvtpryhenfbcii-imjsidkusa-l
- smiles:
- c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
