Difference between revisions of "Tetragalactosyldiacylglycerol"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Malonyl-acp-methyl-ester == * common-name: ** a malonyl-[acp] methyl ester == Reaction(s) known to consume the compound == * [[RXN-11474]...") |
(Created page with "Category:metabolite == Metabolite CPD-19163 == * common-name: ** (2e,11z)-octadecenoyl-coa * molecular-weight: ** 1025.937 * inchi-key: ** opmpwwfmnywbgf-pkybcsrxsa-j * sm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19163 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,11z)-octadecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 1025.937 | ||
| + | * inchi-key: | ||
| + | ** opmpwwfmnywbgf-pkybcsrxsa-j | ||
| + | * smiles: | ||
| + | ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17785]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,11z)-octadecenoyl-coa}} |
| + | {{#set: molecular-weight=1025.937}} | ||
| + | {{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}} | ||
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-19163
- common-name:
- (2e,11z)-octadecenoyl-coa
- molecular-weight:
- 1025.937
- inchi-key:
- opmpwwfmnywbgf-pkybcsrxsa-j
- smiles:
- ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
